C20H25N3O3 — CID 26143522
8-(1-benzofuran-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26143522) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 8-(1-benzofuran-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(1-benzofuran-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26143522 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 8-(1-benzofuran-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)N1C(=O)N(C)C2(CCN(Cc3cc4ccccc4o3)CC2)C1=O |
| InChI | InChI=1S/C20H25N3O3/c1-14(2)23-18(24)20(21(3)19(23)25)8-10-22(11-9-20)13-16-12-15-6-4-5-7-17(15)26-16/h4-7,12,14H,8-11,13H2,1-3H3 |
| InChIKey | HRZTWGYUYZYZSP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|