C18H30N4O3S — CID 26141554
2-[1-(3-methylbutyl)-2,4-dioxo-8-[(3S)-thiolan-3-yl]-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 26141554) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-[1-(3-methylbutyl)-2,4-dioxo-8-[(3S)-thiolan-3-yl]-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | 2-[1-(3-methylbutyl)-2,4-dioxo-8-[(3S)-thiolan-3-yl]-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 26141554 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[1-(3-methylbutyl)-2,4-dioxo-8-[(3S)-thiolan-3-yl]-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CC(C)CCN1C(=O)N(CC(N)=O)C(=O)C12CCN([C@H]1CCSC1)CC2 |
| InChI | InChI=1S/C18H30N4O3S/c1-13(2)3-7-22-17(25)21(11-15(19)23)16(24)18(22)5-8-20(9-6-18)14-4-10-26-12-14/h13-14H,3-12H2,1-2H3,(H2,19,23)/t14-/m0/s1 |
| InChIKey | XTHBAJKNIVLFOG-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|