C15H26N4O4 — CID 26229853
2-[1-ethyl-8-[(2S)-1-methoxypropan-2-yl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 26229853) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[1-ethyl-8-[(2S)-1-methoxypropan-2-yl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | 2-[1-ethyl-8-[(2S)-1-methoxypropan-2-yl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 26229853 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[1-ethyl-8-[(2S)-1-methoxypropan-2-yl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCN1C(=O)N(CC(N)=O)C(=O)C12CCN([C@@H](C)COC)CC2 |
| InChI | InChI=1S/C15H26N4O4/c1-4-19-14(22)18(9-12(16)20)13(21)15(19)5-7-17(8-6-15)11(2)10-23-3/h11H,4-10H2,1-3H3,(H2,16,20)/t11-/m0/s1 |
| InChIKey | BHDTXDDPZLFURU-NSHDSACASA-N |
| XLogP | -0.37 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|