C14H25N3O2S — CID 26221856
1-ethyl-3-methyl-8-[(2S)-1-methylsulfanylpropan-2-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26221856) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-ethyl-3-methyl-8-[(2S)-1-methylsulfanylpropan-2-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-ethyl-3-methyl-8-[(2S)-1-methylsulfanylpropan-2-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26221856 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-ethyl-3-methyl-8-[(2S)-1-methylsulfanylpropan-2-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(C)C(=O)C12CCN([C@@H](C)CSC)CC2 |
| InChI | InChI=1S/C14H25N3O2S/c1-5-17-13(19)15(3)12(18)14(17)6-8-16(9-7-14)11(2)10-20-4/h11H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | DKUFCEDXYALKCD-NSHDSACASA-N |
| XLogP | 1.49 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|