C14H26N4O2 — CID 26220097
3-[2-(dimethylamino)ethyl]-1-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26220097) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26220097 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(CCN(C)C)C(=O)C12CCN(C)CC2 |
| InChI | InChI=1S/C14H26N4O2/c1-5-18-13(20)17(11-10-15(2)3)12(19)14(18)6-8-16(4)9-7-14/h5-11H2,1-4H3 |
| InChIKey | RBZNZASFVGAQGK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|