C12Br10 — CID 26164
1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene (PubChem CID 26164) has the molecular formula C12Br10 and a molecular weight of 943.17 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene |
|---|---|
| PubChem CID | 26164 |
| Molecular Formula | C12Br10 |
| Molecular Weight | 943.17 g/mol |
| Exact Mass | 933.18 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene |
| SMILES | Brc1c(Br)c(Br)c(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C12Br10/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16 |
| InChIKey | AQPHBYQUCKHJLT-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.17 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|