C8H5Br5 — CID 6800
1,2,3,4,5-pentabromo-6-ethylbenzene (PubChem CID 6800) has the molecular formula C8H5Br5 and a molecular weight of 500.65 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-ethylbenzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-ethylbenzene |
|---|---|
| PubChem CID | 6800 |
| Molecular Formula | C8H5Br5 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 495.63 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-ethylbenzene |
| SMILES | CCc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C8H5Br5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H2,1H3 |
| InChIKey | FIAXCDIQXHJNIX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|