C22H26ClFN2O3S — CID 26198625
N-(3-chloro-2,6-diethylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 26198625) has the molecular formula C22H26ClFN2O3S and a molecular weight of 452.98 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26198625 |
| Molecular Formula | C22H26ClFN2O3S |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H26ClFN2O3S/c1-3-15-8-10-18(23)17(4-2)21(15)25-22(27)16-9-11-19(24)20(14-16)30(28,29)26-12-6-5-7-13-26/h8-11,14H,3-7,12-13H2,1-2H3,(H,25,27) |
| InChIKey | BZWWGXCXPRDYBV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |