C25H34N4O3 — CID 26205681
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methylpentanamide (PubChem CID 26205681) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methylpentanamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 26205681 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)N(CCC1=CCCCC1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H34N4O3/c1-18(2)13-14-21(30)28(16-15-19-9-5-3-6-10-19)22-23(26)29(25(32)27-24(22)31)17-20-11-7-4-8-12-20/h4,7-9,11-12,18H,3,5-6,10,13-17,26H2,1-2H3,(H,27,31,32) |
| InChIKey | QLJQZNUKLNMKRN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|