C27H30N4O3S — CID 26205678
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylsulfanylacetamide (PubChem CID 26205678) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 26205678 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylsulfanylacetamide |
| SMILES | Nc1c(N(CCC2=CCCCC2)C(=O)CSc2ccccc2)c(=O)[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C27H30N4O3S/c28-25-24(26(33)29-27(34)31(25)18-21-12-6-2-7-13-21)30(17-16-20-10-4-1-5-11-20)23(32)19-35-22-14-8-3-9-15-22/h2-3,6-10,12-15H,1,4-5,11,16-19,28H2,(H,29,33,34) |
| InChIKey | XICGLGPZMFMPKH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|