C22H25ClN6O2S — CID 24617663
6-amino-1-benzyl-5-[(5-chlorothiadiazol-4-yl)methyl-[2-(cyclohexen-1-yl)ethyl]amino]pyrimidine-2,4-dione (PubChem CID 24617663) has the molecular formula C22H25ClN6O2S and a molecular weight of 473.00 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[(5-chlorothiadiazol-4-yl)methyl-[2-(cyclohexen-1-yl)ethyl]amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[(5-chlorothiadiazol-4-yl)methyl-[2-(cyclohexen-1-yl)ethyl]amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24617663 |
| Molecular Formula | C22H25ClN6O2S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 6-amino-1-benzyl-5-[(5-chlorothiadiazol-4-yl)methyl-[2-(cyclohexen-1-yl)ethyl]amino]pyrimidine-2,4-dione |
| SMILES | Nc1c(N(CCC2=CCCCC2)Cc2nnsc2Cl)c(=O)[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H25ClN6O2S/c23-19-17(26-27-32-19)14-28(12-11-15-7-3-1-4-8-15)18-20(24)29(22(31)25-21(18)30)13-16-9-5-2-6-10-16/h2,5-7,9-10H,1,3-4,8,11-14,24H2,(H,25,30,31) |
| InChIKey | QXYRQMYGCQYGBN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|