C24H30N4O5S — CID 16566521
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 16566521) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 16566521 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | Nc1c(N(CCC2=CCCCC2)C(=O)C2CCS(=O)(=O)C2)c(=O)[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H30N4O5S/c25-21-20(22(29)26-24(31)28(21)15-18-9-5-2-6-10-18)27(13-11-17-7-3-1-4-8-17)23(30)19-12-14-34(32,33)16-19/h2,5-7,9-10,19H,1,3-4,8,11-16,25H2,(H,26,29,31) |
| InChIKey | YFKPQZQZSBBPHJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 135.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|