C26H30N4O2S — CID 26220499
8-(1,3-benzothiazol-2-ylmethyl)-1-benzyl-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26220499) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-2-ylmethyl)-1-benzyl-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(1,3-benzothiazol-2-ylmethyl)-1-benzyl-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26220499 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 8-(1,3-benzothiazol-2-ylmethyl)-1-benzyl-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)CN1C(=O)N(Cc2ccccc2)C2(CCN(Cc3nc4ccccc4s3)CC2)C1=O |
| InChI | InChI=1S/C26H30N4O2S/c1-19(2)16-29-24(31)26(30(25(29)32)17-20-8-4-3-5-9-20)12-14-28(15-13-26)18-23-27-21-10-6-7-11-22(21)33-23/h3-11,19H,12-18H2,1-2H3 |
| InChIKey | LRDJCDUZICUKNY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|