C31H36N4O2 — CID 26230348
8-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]-1-ethyl-3-(naphthalen-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26230348) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 8-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]-1-ethyl-3-(naphthalen-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]-1-ethyl-3-(naphthalen-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26230348 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 8-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]-1-ethyl-3-(naphthalen-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(Cc2cccc3ccccc23)C(=O)C12CCN(C/C=C/c1ccc(N(C)C)cc1)CC2 |
| InChI | InChI=1S/C31H36N4O2/c1-4-35-30(37)34(23-26-12-7-11-25-10-5-6-13-28(25)26)29(36)31(35)18-21-33(22-19-31)20-8-9-24-14-16-27(17-15-24)32(2)3/h5-17H,4,18-23H2,1-3H3/b9-8+ |
| InChIKey | DSQPRBXHNXCVQO-CMDGGOBGSA-N |
| XLogP | 5.24 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|