C22H27BrN2O — CID 30981687
4-(4-bromophenyl)-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-ol (PubChem CID 30981687) has the molecular formula C22H27BrN2O and a molecular weight of 415.38 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-ol.
| Compound Name | 4-(4-bromophenyl)-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 30981687 |
| Molecular Formula | C22H27BrN2O |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-(4-bromophenyl)-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-4-ol |
| SMILES | CN(C)c1ccc(/C=C/CN2CCC(O)(c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27BrN2O/c1-24(2)21-11-5-18(6-12-21)4-3-15-25-16-13-22(26,14-17-25)19-7-9-20(23)10-8-19/h3-12,26H,13-17H2,1-2H3/b4-3+ |
| InChIKey | XSQQMGSQMVQGIX-ONEGZZNKSA-N |
| XLogP | 4.51 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|