C18H27FN2O — CID 77079576
[4-[(dimethylamino)methyl]-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidin-4-yl]methanol (PubChem CID 77079576) has the molecular formula C18H27FN2O and a molecular weight of 306.43 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidin-4-yl]methanol.
| Compound Name | [4-[(dimethylamino)methyl]-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 77079576 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [4-[(dimethylamino)methyl]-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidin-4-yl]methanol |
| SMILES | CN(C)CC1(CO)CCN(C/C=C/c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN2O/c1-20(2)14-18(15-22)9-12-21(13-10-18)11-3-4-16-5-7-17(19)8-6-16/h3-8,22H,9-15H2,1-2H3/b4-3+ |
| InChIKey | BFGGOKJTYAICBY-ONEGZZNKSA-N |
| XLogP | 2.47 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |