C15H22N2O — CID 30981297
N,N-dimethyl-4-[(E)-3-morpholin-4-ylprop-1-enyl]aniline (PubChem CID 30981297) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-3-morpholin-4-ylprop-1-enyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-3-morpholin-4-ylprop-1-enyl]aniline |
|---|---|
| PubChem CID | 30981297 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N,N-dimethyl-4-[(E)-3-morpholin-4-ylprop-1-enyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/CN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H22N2O/c1-16(2)15-7-5-14(6-8-15)4-3-9-17-10-12-18-13-11-17/h3-8H,9-13H2,1-2H3/b4-3+ |
| InChIKey | PCSCBFBHLUAUTB-ONEGZZNKSA-N |
| XLogP | 2.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|