C23H21N3O5S — CID 26231694
(3R)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide (PubChem CID 26231694) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is (3R)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26231694 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (3R)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H]3CCCN(C4=NS(=O)(=O)c5ccccc54)C3)ccc12 |
| InChI | InChI=1S/C23H21N3O5S/c1-14-11-21(27)31-19-12-16(8-9-17(14)19)24-23(28)15-5-4-10-26(13-15)22-18-6-2-3-7-20(18)32(29,30)25-22/h2-3,6-9,11-12,15H,4-5,10,13H2,1H3,(H,24,28)/t15-/m1/s1 |
| InChIKey | DIQXRZMXXPICNS-OAHLLOKOSA-N |
| XLogP | 2.90 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|