C28H23N3O2S — CID 26288653
(5R,5'Z,10bS)-5'-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one (PubChem CID 26288653) has the molecular formula C28H23N3O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is (5R,5'Z,10bS)-5'-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one.
| Compound Name | (5R,5'Z,10bS)-5'-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one |
|---|---|
| PubChem CID | 26288653 |
| Molecular Formula | C28H23N3O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (5R,5'Z,10bS)-5'-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one |
| SMILES | CC(/C=C1\S[C@@]2(NC1=O)Oc1ccccc1[C@@H]1CC(c3ccccc3)=NN12)=C\c1ccccc1 |
| InChI | InChI=1S/C28H23N3O2S/c1-19(16-20-10-4-2-5-11-20)17-26-27(32)29-28(34-26)31-24(22-14-8-9-15-25(22)33-28)18-23(30-31)21-12-6-3-7-13-21/h2-17,24H,18H2,1H3,(H,29,32)/b19-16+,26-17-/t24-,28+/m0/s1 |
| InChIKey | GFHBDGMTSVGDQD-JDUZTGHUSA-N |
| XLogP | 5.69 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|