C26H21N3O4S — CID 26288627
(5R,5'Z,10bR)-5'-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one (PubChem CID 26288627) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is (5R,5'Z,10bR)-5'-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one.
| Compound Name | (5R,5'Z,10bR)-5'-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one |
|---|---|
| PubChem CID | 26288627 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (5R,5'Z,10bR)-5'-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,2'-1,3-thiazolidine]-4'-one |
| SMILES | COc1cc(/C=C2\S[C@@]3(NC2=O)Oc2ccccc2[C@H]2CC(c4ccccc4)=NN23)ccc1O |
| InChI | InChI=1S/C26H21N3O4S/c1-32-23-13-16(11-12-21(23)30)14-24-25(31)27-26(34-24)29-20(18-9-5-6-10-22(18)33-26)15-19(28-29)17-7-3-2-4-8-17/h2-14,20,30H,15H2,1H3,(H,27,31)/b24-14-/t20-,26-/m1/s1 |
| InChIKey | PRIRKPBUWKNSQZ-WWKOKBFGSA-N |
| XLogP | 4.46 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|