C24H21NO4S — CID 2630600
4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 2630600) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 2630600 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3c4cccc5cccc(c45)S3(=O)=O)c2cc1C(C)C |
| InChI | InChI=1S/C24H21NO4S/c1-14(2)18-12-19-17(11-23(26)29-21(19)10-15(18)3)13-25-20-8-4-6-16-7-5-9-22(24(16)20)30(25,27)28/h4-12,14H,13H2,1-3H3 |
| InChIKey | RFZWNDOPKDBCBY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|