C23H29N3O7S — CID 26313997
(3S)-4-(4-ethoxycarbonylanilino)-3-[2-(4-ethylsulfonylanilino)ethylamino]-4-oxobutanoic acid (PubChem CID 26313997) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is (3S)-4-(4-ethoxycarbonylanilino)-3-[2-(4-ethylsulfonylanilino)ethylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-(4-ethoxycarbonylanilino)-3-[2-(4-ethylsulfonylanilino)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 26313997 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (3S)-4-(4-ethoxycarbonylanilino)-3-[2-(4-ethylsulfonylanilino)ethylamino]-4-oxobutanoic acid |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](CC(=O)O)NCCNc2ccc(S(=O)(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O7S/c1-3-33-23(30)16-5-7-18(8-6-16)26-22(29)20(15-21(27)28)25-14-13-24-17-9-11-19(12-10-17)34(31,32)4-2/h5-12,20,24-25H,3-4,13-15H2,1-2H3,(H,26,29)(H,27,28)/t20-/m0/s1 |
| InChIKey | KJPZMGNZVWTIPD-FQEVSTJZSA-N |
| XLogP | 2.14 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|