C28H24FNO4S — CID 26314162
ethyl (4R,6S,7S)-4-(4-fluorophenyl)-2,5-dioxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate (PubChem CID 26314162) has the molecular formula C28H24FNO4S and a molecular weight of 489.57 g/mol. Its IUPAC name is ethyl (4R,6S,7S)-4-(4-fluorophenyl)-2,5-dioxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate.
| Compound Name | ethyl (4R,6S,7S)-4-(4-fluorophenyl)-2,5-dioxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 26314162 |
| Molecular Formula | C28H24FNO4S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | ethyl (4R,6S,7S)-4-(4-fluorophenyl)-2,5-dioxo-1-phenyl-7-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C2=C(C[C@@H]1c1cccs1)N(c1ccccc1)C(=O)C[C@@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C28H24FNO4S/c1-2-34-28(33)26-21(23-9-6-14-35-23)15-22-25(27(26)32)20(17-10-12-18(29)13-11-17)16-24(31)30(22)19-7-4-3-5-8-19/h3-14,20-21,26H,2,15-16H2,1H3/t20-,21-,26+/m1/s1 |
| InChIKey | IRAIJXTYUVMPEQ-YPCDYVTLSA-N |
| XLogP | 5.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|