C30H24F3NO6S — CID 99988236
ethyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,5-dioxo-7-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate (PubChem CID 99988236) has the molecular formula C30H24F3NO6S and a molecular weight of 583.58 g/mol. Its IUPAC name is ethyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,5-dioxo-7-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate.
| Compound Name | ethyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,5-dioxo-7-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 99988236 |
| Molecular Formula | C30H24F3NO6S |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | ethyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,5-dioxo-7-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C2=C(C[C@@H]1c1cccs1)N(c1ccc(C(F)(F)F)cc1)C(=O)C[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H24F3NO6S/c1-2-38-29(37)27-20(24-4-3-11-41-24)13-21-26(28(27)36)19(16-5-10-22-23(12-16)40-15-39-22)14-25(35)34(21)18-8-6-17(7-9-18)30(31,32)33/h3-12,19-20,27H,2,13-15H2,1H3/t19-,20-,27+/m1/s1 |
| InChIKey | PWQPUCYSRZKYQY-DVHCVUMVSA-N |
| XLogP | 6.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|