C22H29ClN6O2 — CID 26316540
1-(4-chlorophenyl)-N-[3-[4-(4-methylpiperazine-1-carbonyl)triazol-1-yl]propyl]cyclobutane-1-carboxamide (PubChem CID 26316540) has the molecular formula C22H29ClN6O2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-[4-(4-methylpiperazine-1-carbonyl)triazol-1-yl]propyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-[4-(4-methylpiperazine-1-carbonyl)triazol-1-yl]propyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 26316540 |
| Molecular Formula | C22H29ClN6O2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-[4-(4-methylpiperazine-1-carbonyl)triazol-1-yl]propyl]cyclobutane-1-carboxamide |
| SMILES | CN1CCN(C(=O)c2cn(CCCNC(=O)C3(c4ccc(Cl)cc4)CCC3)nn2)CC1 |
| InChI | InChI=1S/C22H29ClN6O2/c1-27-12-14-28(15-13-27)20(30)19-16-29(26-25-19)11-3-10-24-21(31)22(8-2-9-22)17-4-6-18(23)7-5-17/h4-7,16H,2-3,8-15H2,1H3,(H,24,31) |
| InChIKey | ZFOLPBSDSMUAGF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|