C24H26ClFN4O — CID 26318707
1-[4-[7-chloro-3-[[2-(2-fluorophenyl)ethylamino]methyl]quinolin-2-yl]piperazin-1-yl]ethanone (PubChem CID 26318707) has the molecular formula C24H26ClFN4O and a molecular weight of 440.95 g/mol. Its IUPAC name is 1-[4-[7-chloro-3-[[2-(2-fluorophenyl)ethylamino]methyl]quinolin-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[7-chloro-3-[[2-(2-fluorophenyl)ethylamino]methyl]quinolin-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 26318707 |
| Molecular Formula | C24H26ClFN4O |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[4-[7-chloro-3-[[2-(2-fluorophenyl)ethylamino]methyl]quinolin-2-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2nc3cc(Cl)ccc3cc2CNCCc2ccccc2F)CC1 |
| InChI | InChI=1S/C24H26ClFN4O/c1-17(31)29-10-12-30(13-11-29)24-20(14-19-6-7-21(25)15-23(19)28-24)16-27-9-8-18-4-2-3-5-22(18)26/h2-7,14-15,27H,8-13,16H2,1H3 |
| InChIKey | PVYYOCXVHGYWCS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|