C19H22ClN3O — CID 26322362
5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-(3-chlorophenyl)-1,2,4-oxadiazole (PubChem CID 26322362) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-(3-chlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-(3-chlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26322362 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-(3-chlorophenyl)-1,2,4-oxadiazole |
| SMILES | C=CCC1(CC=C)CCCN1Cc1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C19H22ClN3O/c1-3-9-19(10-4-2)11-6-12-23(19)14-17-21-18(22-24-17)15-7-5-8-16(20)13-15/h3-5,7-8,13H,1-2,6,9-12,14H2 |
| InChIKey | VETVWCALTIWLFT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|