C18H22N4O — CID 26409904
5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 26409904) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26409904 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 5-[[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]methyl]-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | C=CCC1(CC=C)CCCN1Cc1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C18H22N4O/c1-3-9-18(10-4-2)11-7-13-22(18)14-16-20-17(21-23-16)15-8-5-6-12-19-15/h3-6,8,12H,1-2,7,9-11,13-14H2 |
| InChIKey | KHFCISGPLFRXRN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|