C12H8ClN5O2 — CID 66216210
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde (PubChem CID 66216210) has the molecular formula C12H8ClN5O2 and a molecular weight of 289.68 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 66216210 |
| Molecular Formula | C12H8ClN5O2 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde |
| SMILES | O=Cc1cn(Cc2nc(-c3cccc(Cl)c3)no2)nn1 |
| InChI | InChI=1S/C12H8ClN5O2/c13-9-3-1-2-8(4-9)12-14-11(20-16-12)6-18-5-10(7-19)15-17-18/h1-5,7H,6H2 |
| InChIKey | PAJBCFHOJPRHQR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|