C13H11N5O2 — CID 66215802
1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde (PubChem CID 66215802) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde.
| Compound Name | 1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 66215802 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazole-4-carbaldehyde |
| SMILES | Cc1ccc(-c2noc(Cn3cc(C=O)nn3)n2)cc1 |
| InChI | InChI=1S/C13H11N5O2/c1-9-2-4-10(5-3-9)13-14-12(20-16-13)7-18-6-11(8-19)15-17-18/h2-6,8H,7H2,1H3 |
| InChIKey | DZTWNDYJWYMJBS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|