C26H20N6O2 — CID 118796680
10-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazol-4-yl]methyl]acridin-9-one (PubChem CID 118796680) has the molecular formula C26H20N6O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 10-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazol-4-yl]methyl]acridin-9-one.
| Compound Name | 10-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazol-4-yl]methyl]acridin-9-one |
|---|---|
| PubChem CID | 118796680 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 10-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]triazol-4-yl]methyl]acridin-9-one |
| SMILES | Cc1ccc(-c2noc(Cn3cc(Cn4c5ccccc5c(=O)c5ccccc54)nn3)n2)cc1 |
| InChI | InChI=1S/C26H20N6O2/c1-17-10-12-18(13-11-17)26-27-24(34-29-26)16-31-14-19(28-30-31)15-32-22-8-4-2-6-20(22)25(33)21-7-3-5-9-23(21)32/h2-14H,15-16H2,1H3 |
| InChIKey | VIFZAYVVOXUEPB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|