C13H12BrN5O — CID 62401990
5-[[4-(bromomethyl)triazol-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 62401990) has the molecular formula C13H12BrN5O and a molecular weight of 334.18 g/mol. Its IUPAC name is 5-[[4-(bromomethyl)triazol-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(bromomethyl)triazol-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 62401990 |
| Molecular Formula | C13H12BrN5O |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5-[[4-(bromomethyl)triazol-1-yl]methyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(Cn3cc(CBr)nn3)n2)cc1 |
| InChI | InChI=1S/C13H12BrN5O/c1-9-2-4-10(5-3-9)13-15-12(20-17-13)8-19-7-11(6-14)16-18-19/h2-5,7H,6,8H2,1H3 |
| InChIKey | LQXRVEIXSVGFLB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|