C25H21N5O3S — CID 171988460
1,3-dimethyl-5-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 171988460) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dimethyl-5-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 171988460 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1,3-dimethyl-5-[[1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(-c2noc(Cn3cc(C=C4C(=O)N(C)C(=S)N(C)C4=O)c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C25H21N5O3S/c1-15-8-10-16(11-9-15)22-26-21(33-27-22)14-30-13-17(18-6-4-5-7-20(18)30)12-19-23(31)28(2)25(34)29(3)24(19)32/h4-13H,14H2,1-3H3 |
| InChIKey | LUEBLFRMUBBPKU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|