C34H27N3O3 — CID 162779322
1,2-bis(4-methylphenyl)-4-[(1-phenacylindol-3-yl)methylidene]pyrazolidine-3,5-dione (PubChem CID 162779322) has the molecular formula C34H27N3O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is 1,2-bis(4-methylphenyl)-4-[(1-phenacylindol-3-yl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1,2-bis(4-methylphenyl)-4-[(1-phenacylindol-3-yl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 162779322 |
| Molecular Formula | C34H27N3O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 1,2-bis(4-methylphenyl)-4-[(1-phenacylindol-3-yl)methylidene]pyrazolidine-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3cn(CC(=O)c4ccccc4)c4ccccc34)C(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H27N3O3/c1-23-12-16-27(17-13-23)36-33(39)30(34(40)37(36)28-18-14-24(2)15-19-28)20-26-21-35(31-11-7-6-10-29(26)31)22-32(38)25-8-4-3-5-9-25/h3-21H,22H2,1-2H3 |
| InChIKey | ANAATWFOTVXKAA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|