C14H12N4O2 — CID 66214186
1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]triazole-4-carbaldehyde (PubChem CID 66214186) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]triazole-4-carbaldehyde.
| Compound Name | 1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 66214186 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]triazole-4-carbaldehyde |
| SMILES | Cc1ccc(-c2nc(Cn3cc(C=O)nn3)co2)cc1 |
| InChI | InChI=1S/C14H12N4O2/c1-10-2-4-11(5-3-10)14-15-13(9-20-14)7-18-6-12(8-19)16-17-18/h2-6,8-9H,7H2,1H3 |
| InChIKey | VBVVJGWRGLCFGZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|