C14H12N4O3 — CID 107461356
2-[1-[(2-phenyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]acetic acid (PubChem CID 107461356) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-[1-[(2-phenyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]acetic acid.
| Compound Name | 2-[1-[(2-phenyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461356 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[1-[(2-phenyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(Cc2coc(-c3ccccc3)n2)nn1 |
| InChI | InChI=1S/C14H12N4O3/c19-13(20)6-11-7-18(17-16-11)8-12-9-21-14(15-12)10-4-2-1-3-5-10/h1-5,7,9H,6,8H2,(H,19,20) |
| InChIKey | HZDFBAFDXMKTRA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |