C8H8N4O2 — CID 66215800
1-[(5-methyl-1,2-oxazol-3-yl)methyl]triazole-4-carbaldehyde (PubChem CID 66215800) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 1-[(5-methyl-1,2-oxazol-3-yl)methyl]triazole-4-carbaldehyde.
| Compound Name | 1-[(5-methyl-1,2-oxazol-3-yl)methyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 66215800 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1-[(5-methyl-1,2-oxazol-3-yl)methyl]triazole-4-carbaldehyde |
| SMILES | Cc1cc(Cn2cc(C=O)nn2)no1 |
| InChI | InChI=1S/C8H8N4O2/c1-6-2-7(10-14-6)3-12-4-8(5-13)9-11-12/h2,4-5H,3H2,1H3 |
| InChIKey | JFLMMPURSUUJDT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|