C15H14N4O5S — CID 2632673
2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 2632673) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2632673 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nnc(-c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C15H14N4O5S/c1-2-5-16-14(21)17-12(20)7-25-15-19-18-13(24-15)9-3-4-10-11(6-9)23-8-22-10/h2-4,6H,1,5,7-8H2,(H2,16,17,20,21) |
| InChIKey | BTTLRQMJAWUKHY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|