C17H20N4O6S — CID 4823181
2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-ethoxypropylcarbamoyl)acetamide (PubChem CID 4823181) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-ethoxypropylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-ethoxypropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 4823181 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(3-ethoxypropylcarbamoyl)acetamide |
| SMILES | CCOCCCNC(=O)NC(=O)CSc1nnc(-c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C17H20N4O6S/c1-2-24-7-3-6-18-16(23)19-14(22)9-28-17-21-20-15(27-17)11-4-5-12-13(8-11)26-10-25-12/h4-5,8H,2-3,6-7,9-10H2,1H3,(H2,18,19,22,23) |
| InChIKey | YXNDSHVSWUMMSB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|