C21H17ClN2O3S — CID 2632900
N-(3-chlorophenyl)-3-(2,3-dihydroindole-1-carbonyl)benzenesulfonamide (PubChem CID 2632900) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(2,3-dihydroindole-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-3-(2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2632900 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(3-chlorophenyl)-3-(2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
| SMILES | O=C(c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H17ClN2O3S/c22-17-7-4-8-18(14-17)23-28(26,27)19-9-3-6-16(13-19)21(25)24-12-11-15-5-1-2-10-20(15)24/h1-10,13-14,23H,11-12H2 |
| InChIKey | FZTWQVJAHJHIAA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |