C23H35N3O3 — CID 26332879
(5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[3-(2-oxopyrrolidin-1-yl)propyl]piperidin-2-one (PubChem CID 26332879) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is (5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[3-(2-oxopyrrolidin-1-yl)propyl]piperidin-2-one.
| Compound Name | (5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[3-(2-oxopyrrolidin-1-yl)propyl]piperidin-2-one |
|---|---|
| PubChem CID | 26332879 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[3-(2-oxopyrrolidin-1-yl)propyl]piperidin-2-one |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)[C@H]1CCC(=O)N(CCCN2CCCC2=O)C1 |
| InChI | InChI=1S/C23H35N3O3/c1-3-11-23(12-4-2)13-6-17-26(23)22(29)19-9-10-21(28)25(18-19)16-7-15-24-14-5-8-20(24)27/h3-4,19H,1-2,5-18H2/t19-/m0/s1 |
| InChIKey | XUCHXXUWSWNXMH-IBGZPJMESA-N |
| XLogP | 2.75 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|