C21H32N2O5 — CID 26336414
methyl 3-[(3S,4R)-1-[(2-hydroxy-5-methoxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate (PubChem CID 26336414) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 3-[(3S,4R)-1-[(2-hydroxy-5-methoxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S,4R)-1-[(2-hydroxy-5-methoxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 26336414 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | methyl 3-[(3S,4R)-1-[(2-hydroxy-5-methoxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CN(Cc2cc(OC)ccc2O)CC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C21H32N2O5/c1-26-18-4-5-20(24)17(13-18)15-22-8-7-19(23-9-11-28-12-10-23)16(14-22)3-6-21(25)27-2/h4-5,13,16,19,24H,3,6-12,14-15H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | WGOAUQICISFOOQ-QFBILLFUSA-N |
| XLogP | 1.88 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|