C26H33ClFN3O3 — CID 29258919
methyl 3-[(3S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-3-yl]propanoate (PubChem CID 29258919) has the molecular formula C26H33ClFN3O3 and a molecular weight of 490.02 g/mol. Its IUPAC name is methyl 3-[(3S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 29258919 |
| Molecular Formula | C26H33ClFN3O3 |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | methyl 3-[(3S,4R)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CN(Cc2cc(Cl)ccc2O)CC[C@H]1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H33ClFN3O3/c1-34-26(33)9-6-19-17-29(18-20-16-21(27)7-8-25(20)32)11-10-23(19)30-12-14-31(15-13-30)24-5-3-2-4-22(24)28/h2-5,7-8,16,19,23,32H,6,9-15,17-18H2,1H3/t19-,23+/m0/s1 |
| InChIKey | UKGBTMJIACCEAH-WMZHIEFXSA-N |
| XLogP | 4.15 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|