C18H30N2O2 — CID 26338640
4-(2-methoxyethyl)-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepan-5-one (PubChem CID 26338640) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepan-5-one.
| Compound Name | 4-(2-methoxyethyl)-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26338640 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 4-(2-methoxyethyl)-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepan-5-one |
| SMILES | C=C(C)[C@@H]1CC=C(CN2CCC(=O)N(CCOC)CC2)CC1 |
| InChI | InChI=1S/C18H30N2O2/c1-15(2)17-6-4-16(5-7-17)14-19-9-8-18(21)20(11-10-19)12-13-22-3/h4,17H,1,5-14H2,2-3H3/t17-/m1/s1 |
| InChIKey | IOEBATANFHMBQM-QGZVFWFLSA-N |
| XLogP | 2.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|