C24H25F3N4OS — CID 26338800
N-[3-[4-[2-(1,3-thiazol-4-yl)ethylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 26338800) has the molecular formula C24H25F3N4OS and a molecular weight of 474.55 g/mol. Its IUPAC name is N-[3-[4-[2-(1,3-thiazol-4-yl)ethylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-[2-(1,3-thiazol-4-yl)ethylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 26338800 |
| Molecular Formula | C24H25F3N4OS |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[3-[4-[2-(1,3-thiazol-4-yl)ethylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCC(NCCc3cscn3)CC2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N4OS/c25-24(26,27)18-4-1-3-17(13-18)23(32)30-20-5-2-6-22(14-20)31-11-8-19(9-12-31)28-10-7-21-15-33-16-29-21/h1-6,13-16,19,28H,7-12H2,(H,30,32) |
| InChIKey | HKODYIZIDDDZLE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|