C27H29F3N4O — CID 25294988
N-[3-[4-(3-pyridin-4-ylpropylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 25294988) has the molecular formula C27H29F3N4O and a molecular weight of 482.55 g/mol. Its IUPAC name is N-[3-[4-(3-pyridin-4-ylpropylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-(3-pyridin-4-ylpropylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 25294988 |
| Molecular Formula | C27H29F3N4O |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | N-[3-[4-(3-pyridin-4-ylpropylamino)piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCC(NCCCc3ccncc3)CC2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H29F3N4O/c28-27(29,30)22-6-1-5-21(18-22)26(35)33-24-7-2-8-25(19-24)34-16-11-23(12-17-34)32-13-3-4-20-9-14-31-15-10-20/h1-2,5-10,14-15,18-19,23,32H,3-4,11-13,16-17H2,(H,33,35) |
| InChIKey | BSSOZLKXGAAQEH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|