C24H28F3N3O3S — CID 42166182
N-[3-[4-[[(3S)-1,1-dioxothiolan-3-yl]methylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 42166182) has the molecular formula C24H28F3N3O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[3-[4-[[(3S)-1,1-dioxothiolan-3-yl]methylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-[[(3S)-1,1-dioxothiolan-3-yl]methylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42166182 |
| Molecular Formula | C24H28F3N3O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[3-[4-[[(3S)-1,1-dioxothiolan-3-yl]methylamino]piperidin-1-yl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCC(NC[C@@H]3CCS(=O)(=O)C3)CC2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F3N3O3S/c25-24(26,27)19-4-1-3-18(13-19)23(31)29-21-5-2-6-22(14-21)30-10-7-20(8-11-30)28-15-17-9-12-34(32,33)16-17/h1-6,13-14,17,20,28H,7-12,15-16H2,(H,29,31)/t17-/m0/s1 |
| InChIKey | JTWYYRDISHUUIT-KRWDZBQOSA-N |
| XLogP | 3.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|