C26H25N3O4S — CID 26351594
methyl 3-[[(2,3-dimethyl-1H-indole-7-carbonyl)amino]methyl]-5-[(2-thiophen-3-ylacetyl)amino]benzoate (PubChem CID 26351594) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is methyl 3-[[(2,3-dimethyl-1H-indole-7-carbonyl)amino]methyl]-5-[(2-thiophen-3-ylacetyl)amino]benzoate.
| Compound Name | methyl 3-[[(2,3-dimethyl-1H-indole-7-carbonyl)amino]methyl]-5-[(2-thiophen-3-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 26351594 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl 3-[[(2,3-dimethyl-1H-indole-7-carbonyl)amino]methyl]-5-[(2-thiophen-3-ylacetyl)amino]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2cccc3c(C)c(C)[nH]c23)cc(NC(=O)Cc2ccsc2)c1 |
| InChI | InChI=1S/C26H25N3O4S/c1-15-16(2)28-24-21(15)5-4-6-22(24)25(31)27-13-18-9-19(26(32)33-3)12-20(10-18)29-23(30)11-17-7-8-34-14-17/h4-10,12,14,28H,11,13H2,1-3H3,(H,27,31)(H,29,30) |
| InChIKey | QYBUSCJUYNHVNO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|