C27H34N4O3 — CID 26359751
1-cyclopentyl-5-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 26359751) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-cyclopentyl-5-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 1-cyclopentyl-5-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 26359751 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-cyclopentyl-5-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1cn(C2CCCC2)cc(C(=O)N2CCN(c3ccc(C)cc3C)CC2)c1=O |
| InChI | InChI=1S/C27H34N4O3/c1-4-11-28-26(33)22-17-31(21-7-5-6-8-21)18-23(25(22)32)27(34)30-14-12-29(13-15-30)24-10-9-19(2)16-20(24)3/h4,9-10,16-18,21H,1,5-8,11-15H2,2-3H3,(H,28,33) |
| InChIKey | PMELUQWLNLJSRS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|