C27H34N4O4 — CID 31054737
1-cyclopentyl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 31054737) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-cyclopentyl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 1-cyclopentyl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 31054737 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-cyclopentyl-5-[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1cn(C2CCCC2)cc(C(=O)N2CCN(Cc3ccccc3OC)CC2)c1=O |
| InChI | InChI=1S/C27H34N4O4/c1-3-12-28-26(33)22-18-31(21-9-5-6-10-21)19-23(25(22)32)27(34)30-15-13-29(14-16-30)17-20-8-4-7-11-24(20)35-2/h3-4,7-8,11,18-19,21H,1,5-6,9-10,12-17H2,2H3,(H,28,33) |
| InChIKey | KZFZNCCAFQOARR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|